CymitQuimica logo

CAS 1346698-02-9

:

3,4-Dichloro-5-(1-methylpropoxy)pyridazine

Description:
3,4-Dichloro-5-(1-methylpropoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of two chlorine atoms at the 3 and 4 positions contributes to its reactivity and potential applications in various chemical processes. The substituent 1-methylpropoxy at the 5 position enhances its solubility and may influence its biological activity. This compound is typically synthesized through specific organic reactions that introduce the chlorine and alkoxy groups onto the pyridazine ring. Its properties, such as melting point, boiling point, and solubility, can vary based on the molecular interactions and the presence of functional groups. 3,4-Dichloro-5-(1-methylpropoxy)pyridazine may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific uses would depend on further research into its biological and chemical behavior. Safety data and handling precautions should be consulted due to the presence of chlorine, which can pose health risks.
Formula:C8H10Cl2N2O
InChI:InChI=1S/C8H10Cl2N2O/c1-3-5(2)13-6-4-11-12-8(10)7(6)9/h4-5H,3H2,1-2H3
InChI key:InChIKey=GAPYMMFBNJRFTE-UHFFFAOYSA-N
SMILES:O(C(CC)C)C=1C(Cl)=C(Cl)N=NC1
Synonyms:
  • 3,4-Dichloro-5-(1-methylpropoxy)pyridazine
  • Pyridazine, 3,4-dichloro-5-(1-methylpropoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.