CAS 1346698-06-3
:3,4-Dichloro-5-(2-methylbutoxy)pyridazine
Description:
3,4-Dichloro-5-(2-methylbutoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of two chlorine atoms at the 3 and 4 positions of the pyridazine ring contributes to its reactivity and potential applications in various chemical processes. The substituent at the 5 position, a 2-methylbutoxy group, introduces hydrophobic characteristics, which can influence the compound's solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research or agrochemical applications. Its molecular structure suggests potential for various synthetic modifications, which could enhance its properties or efficacy. As with many halogenated compounds, safety and environmental considerations are important, particularly regarding its persistence and potential toxicity. Overall, 3,4-Dichloro-5-(2-methylbutoxy)pyridazine represents a unique structure with diverse implications in chemical research and application.
Formula:C9H12Cl2N2O
InChI:InChI=1S/C9H12Cl2N2O/c1-3-6(2)5-14-7-4-12-13-9(11)8(7)10/h4,6H,3,5H2,1-2H3
InChI key:InChIKey=MWOQOASURLORLH-UHFFFAOYSA-N
SMILES:O(CC(CC)C)C=1C(Cl)=C(Cl)N=NC1
Synonyms:- 3,4-Dichloro-5-(2-methylbutoxy)pyridazine
- Pyridazine, 3,4-dichloro-5-(2-methylbutoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
