CymitQuimica logo

CAS 1346698-08-5

:

3,4-Dichloro-5-(2,2-dimethylpropoxy)pyridazine

Description:
3,4-Dichloro-5-(2,2-dimethylpropoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of two chlorine atoms at the 3 and 4 positions contributes to its reactivity and potential applications in various chemical processes. The substituent 2,2-dimethylpropoxy group at the 5 position enhances its lipophilicity, which may influence its solubility and biological activity. This compound is likely to exhibit properties typical of halogenated organic compounds, such as increased stability and potential for forming hydrogen bonds due to the electronegative chlorine atoms. Its unique structure may render it useful in agrochemical formulations or as an intermediate in organic synthesis. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, 3,4-Dichloro-5-(2,2-dimethylpropoxy)pyridazine represents a complex organic molecule with potential applications in various fields of chemistry.
Formula:C9H12Cl2N2O
InChI:InChI=1S/C9H12Cl2N2O/c1-9(2,3)5-14-6-4-12-13-8(11)7(6)10/h4H,5H2,1-3H3
InChI key:InChIKey=WQCYYAWEDRSDKU-UHFFFAOYSA-N
SMILES:O(CC(C)(C)C)C=1C(Cl)=C(Cl)N=NC1
Synonyms:
  • Pyridazine, 3,4-dichloro-5-(2,2-dimethylpropoxy)-
  • 3,4-Dichloro-5-(2,2-dimethylpropoxy)pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.