CymitQuimica logo

CAS 1346698-10-9

:

3,4-Dichloro-5-(cyclopropyloxy)pyridazine

Description:
3,4-Dichloro-5-(cyclopropyloxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of two chlorine atoms at the 3 and 4 positions of the pyridazine ring contributes to its reactivity and potential biological activity. The cyclopropyloxy group at the 5 position introduces a unique structural feature, as cyclopropyl groups are known for their strain and can influence the compound's interaction with biological targets. This compound may exhibit properties such as lipophilicity due to the presence of the cyclopropyl moiety, which can affect its solubility and permeability in biological systems. Additionally, the dichloro substitution pattern may enhance its stability and alter its electronic properties. Overall, 3,4-Dichloro-5-(cyclopropyloxy)pyridazine is of interest in medicinal chemistry and may have applications in drug development, particularly in targeting specific biological pathways or receptors.
Formula:C7H6Cl2N2O
InChI:InChI=1S/C7H6Cl2N2O/c8-6-5(12-4-1-2-4)3-10-11-7(6)9/h3-4H,1-2H2
InChI key:InChIKey=CAYZZLUDUKSIRC-UHFFFAOYSA-N
SMILES:O(C=1C(Cl)=C(Cl)N=NC1)C2CC2
Synonyms:
  • 3,4-Dichloro-5-(cyclopropyloxy)pyridazine
  • Pyridazine, 3,4-dichloro-5-(cyclopropyloxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.