CymitQuimica logo

CAS 1346698-12-1

:

3,4-Dichloro-5-(cyclopentyloxy)pyridazine

Description:
3,4-Dichloro-5-(cyclopentyloxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of two chlorine atoms at the 3 and 4 positions contributes to its reactivity and potential biological activity. The cyclopentyloxy group at the 5 position introduces a hydrophobic character, which can influence the compound's solubility and interaction with biological membranes. This compound may exhibit various properties, including potential use in pharmaceuticals or agrochemicals, depending on its biological activity and mechanism of action. Its molecular structure suggests that it could participate in hydrogen bonding and other intermolecular interactions, which are critical for its behavior in different environments. Additionally, the presence of halogens often enhances the compound's stability and can affect its metabolic pathways. Overall, 3,4-Dichloro-5-(cyclopentyloxy)pyridazine is a complex molecule with potential applications in various fields, warranting further investigation into its properties and uses.
Formula:C9H10Cl2N2O
InChI:InChI=1S/C9H10Cl2N2O/c10-8-7(5-12-13-9(8)11)14-6-3-1-2-4-6/h5-6H,1-4H2
InChI key:InChIKey=LDRHVDIIVANZER-UHFFFAOYSA-N
SMILES:O(C=1C(Cl)=C(Cl)N=NC1)C2CCCC2
Synonyms:
  • Pyridazine, 3,4-dichloro-5-(cyclopentyloxy)-
  • 3,4-Dichloro-5-(cyclopentyloxy)pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.