CAS 1346698-16-5
:3,4-Dichloro-5-(cyclobutylmethoxy)pyridazine
Description:
3,4-Dichloro-5-(cyclobutylmethoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of two chlorine atoms at the 3 and 4 positions contributes to its reactivity and potential biological activity. The cyclobutylmethoxy group at the 5 position introduces a unique structural feature that may influence the compound's solubility and interaction with biological targets. This compound is likely to exhibit moderate to high lipophilicity due to the cyclobutyl moiety, which can affect its pharmacokinetic properties. Additionally, the dichloro substitution pattern may enhance its stability and alter its electronic properties, making it of interest in medicinal chemistry and material science. As with many halogenated compounds, it may also exhibit specific environmental and safety considerations, necessitating careful handling and assessment in research and application contexts.
Formula:C9H10Cl2N2O
InChI:InChI=1S/C9H10Cl2N2O/c10-8-7(4-12-13-9(8)11)14-5-6-2-1-3-6/h4,6H,1-3,5H2
InChI key:InChIKey=QOVDTGOIHOOYOC-UHFFFAOYSA-N
SMILES:O(CC1CCC1)C=2C(Cl)=C(Cl)N=NC2
Synonyms:- Pyridazine, 3,4-dichloro-5-(cyclobutylmethoxy)-
- 3,4-Dichloro-5-(cyclobutylmethoxy)pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
