CAS 1346698-17-6
:3,4-Dichloro-5-(cyclopentylmethoxy)pyridazine
Description:
3,4-Dichloro-5-(cyclopentylmethoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of two chlorine atoms at the 3 and 4 positions of the pyridazine ring contributes to its reactivity and potential biological activity. The substituent at the 5 position, a cyclopentylmethoxy group, introduces hydrophobic characteristics, which can influence the compound's solubility and interaction with biological membranes. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting certain biological pathways. The presence of halogens often enhances the compound's stability and can affect its metabolic profile. Overall, 3,4-Dichloro-5-(cyclopentylmethoxy)pyridazine is a complex molecule with unique characteristics that may be explored for various chemical and biological applications.
Formula:C10H12Cl2N2O
InChI:InChI=1S/C10H12Cl2N2O/c11-9-8(5-13-14-10(9)12)15-6-7-3-1-2-4-7/h5,7H,1-4,6H2
InChI key:InChIKey=UIULXEUTGWIOTG-UHFFFAOYSA-N
SMILES:O(CC1CCCC1)C=2C(Cl)=C(Cl)N=NC2
Synonyms:- Pyridazine, 3,4-dichloro-5-(cyclopentylmethoxy)-
- 3,4-Dichloro-5-(cyclopentylmethoxy)pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
