CAS 1346698-19-8
:3,4-Dichloro-5-(phenylmethoxy)pyridazine
Description:
3,4-Dichloro-5-(phenylmethoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of two chlorine atoms at the 3 and 4 positions of the pyridazine ring contributes to its reactivity and potential biological activity. The phenylmethoxy group at the 5 position enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. This compound may exhibit various properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals, depending on its specific interactions and reactivity. Its molecular structure suggests that it could participate in electrophilic substitution reactions due to the electron-withdrawing effects of the chlorine atoms. Additionally, the presence of the methoxy group may provide sites for further functionalization. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application.
Formula:C11H8Cl2N2O
InChI:InChI=1S/C11H8Cl2N2O/c12-10-9(6-14-15-11(10)13)16-7-8-4-2-1-3-5-8/h1-6H,7H2
InChI key:InChIKey=OWEKOOIIOJCMBS-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C(Cl)=C(Cl)N=NC2
Synonyms:- 3,4-Dichloro-5-(phenylmethoxy)pyridazine
- Pyridazine, 3,4-dichloro-5-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
