CAS 1346698-21-2
:3,4-Dichloro-5-(3,3,3-trifluoropropoxy)pyridazine
Description:
3,4-Dichloro-5-(3,3,3-trifluoropropoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of two chlorine atoms at the 3 and 4 positions of the pyridazine ring contributes to its reactivity and potential biological activity. The substituent at the 5 position, a 3,3,3-trifluoropropoxy group, introduces significant fluorine content, which can enhance lipophilicity and influence the compound's interaction with biological systems. This compound may exhibit properties such as increased stability and resistance to metabolic degradation due to the fluorinated moiety. Its unique structure suggests potential applications in agrochemicals or pharmaceuticals, although specific biological activities would depend on further empirical studies. Safety and handling considerations are essential, given the presence of halogenated compounds, which may pose environmental and health risks. As with any chemical, proper characterization through techniques like NMR, IR, and mass spectrometry is crucial for understanding its properties and potential applications.
Formula:C7H5Cl2F3N2O
InChI:InChI=1S/C7H5Cl2F3N2O/c8-5-4(3-13-14-6(5)9)15-2-1-7(10,11)12/h3H,1-2H2
InChI key:InChIKey=SIIPTXGDFRAJKK-UHFFFAOYSA-N
SMILES:O(CCC(F)(F)F)C=1C(Cl)=C(Cl)N=NC1
Synonyms:- 3,4-Dichloro-5-(3,3,3-trifluoropropoxy)pyridazine
- Pyridazine, 3,4-dichloro-5-(3,3,3-trifluoropropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
