CAS 1346698-23-4
:Methyl 2-[(5,6-dichloro-4-pyridazinyl)oxy]acetate
Description:
Methyl 2-[(5,6-dichloro-4-pyridazinyl)oxy]acetate is a chemical compound characterized by its unique structure, which includes a pyridazine ring substituted with two chlorine atoms and an ether linkage to a methyl acetate group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate polarity due to the presence of the ester functional group. The dichloro substitution on the pyridazine ring may impart specific reactivity and biological activity, making it of interest in various fields such as medicinal chemistry and agrochemicals. The compound is likely to be soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic system. Additionally, the presence of chlorine atoms can influence its environmental persistence and toxicity. As with many synthetic organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, Methyl 2-[(5,6-dichloro-4-pyridazinyl)oxy]acetate represents a class of compounds with diverse applications and significant chemical properties.
Formula:C7H6Cl2N2O3
InChI:InChI=1S/C7H6Cl2N2O3/c1-13-5(12)3-14-4-2-10-11-7(9)6(4)8/h2H,3H2,1H3
InChI key:InChIKey=BHBTWENTIWOUOM-UHFFFAOYSA-N
SMILES:O(CC(OC)=O)C=1C(Cl)=C(Cl)N=NC1
Synonyms:- Methyl 2-[(5,6-dichloro-4-pyridazinyl)oxy]acetate
- Acetic acid, 2-[(5,6-dichloro-4-pyridazinyl)oxy]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
