CAS 1346698-24-5
:Ethyl 2-[(5,6-dichloro-4-pyridazinyl)oxy]acetate
Description:
Ethyl 2-[(5,6-dichloro-4-pyridazinyl)oxy]acetate is a chemical compound characterized by its unique structure, which includes an ethyl ester group and a pyridazine moiety substituted with dichloro groups. This compound typically exhibits properties associated with both esters and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the pyridazine ring. The dichloro substituents can influence its electronic properties and reactivity, potentially enhancing its biological activity or interaction with other chemical species. Ethyl 2-[(5,6-dichloro-4-pyridazinyl)oxy]acetate may be of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential applications as a pharmaceutical intermediate or a pesticide. Its synthesis and handling would require standard laboratory safety protocols, given the presence of chlorine atoms, which can pose health and environmental risks. Overall, this compound represents a specific class of organic molecules with diverse applications based on its structural characteristics.
Formula:C8H8Cl2N2O3
InChI:InChI=1S/C8H8Cl2N2O3/c1-2-14-6(13)4-15-5-3-11-12-8(10)7(5)9/h3H,2,4H2,1H3
InChI key:InChIKey=PNHKDQUTRFNFOC-UHFFFAOYSA-N
SMILES:O(CC(OCC)=O)C=1C(Cl)=C(Cl)N=NC1
Synonyms:- Acetic acid, 2-[(5,6-dichloro-4-pyridazinyl)oxy]-, ethyl ester
- Ethyl 2-[(5,6-dichloro-4-pyridazinyl)oxy]acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
