CymitQuimica logo

CAS 1346698-25-6

:

Methyl 3-[(5,6-dichloro-4-pyridazinyl)oxy]propanoate

Description:
Methyl 3-[(5,6-dichloro-4-pyridazinyl)oxy]propanoate is a chemical compound characterized by its unique structure, which includes a pyridazine ring substituted with two chlorine atoms and an ether linkage to a propanoate moiety. This compound typically exhibits properties associated with both the ester functional group and the heterocyclic aromatic system. The presence of chlorine atoms can influence its reactivity, solubility, and biological activity, often enhancing lipophilicity and potentially affecting pharmacokinetics if used in medicinal chemistry. Methyl esters generally have a pleasant odor and are often used as intermediates in organic synthesis. The compound's molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of herbicides or other bioactive agents. Additionally, the pyridazine ring may contribute to specific interactions with biological targets, making it of interest in drug discovery. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.
Formula:C8H8Cl2N2O3
InChI:InChI=1S/C8H8Cl2N2O3/c1-14-6(13)2-3-15-5-4-11-12-8(10)7(5)9/h4H,2-3H2,1H3
InChI key:InChIKey=PYLDXBBLJHCTFT-UHFFFAOYSA-N
SMILES:O(CCC(OC)=O)C=1C(Cl)=C(Cl)N=NC1
Synonyms:
  • Methyl 3-[(5,6-dichloro-4-pyridazinyl)oxy]propanoate
  • Propanoic acid, 3-[(5,6-dichloro-4-pyridazinyl)oxy]-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.