CymitQuimica logo

CAS 1346698-27-8

:

3,4-Dichloro-5-(2-chloroethoxy)pyridazine

Description:
3,4-Dichloro-5-(2-chloroethoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of two chlorine atoms at the 3 and 4 positions of the pyridazine ring contributes to its reactivity and potential biological activity. The substituent at the 5 position, a 2-chloroethoxy group, introduces an ether functionality, which can influence the compound's solubility and interaction with biological systems. This compound may exhibit properties typical of halogenated organic compounds, such as increased lipophilicity and potential for environmental persistence. Its structure suggests potential applications in agrochemicals or pharmaceuticals, although specific biological activities would depend on further empirical studies. Safety and handling considerations are essential due to the presence of chlorine, which can pose health risks. As with many synthetic compounds, understanding its environmental impact and degradation pathways is crucial for responsible use.
Formula:C6H5Cl3N2O
InChI:InChI=1S/C6H5Cl3N2O/c7-1-2-12-4-3-10-11-6(9)5(4)8/h3H,1-2H2
InChI key:InChIKey=DBDQKGYBBMLBKS-UHFFFAOYSA-N
SMILES:O(CCCl)C=1C(Cl)=C(Cl)N=NC1
Synonyms:
  • Pyridazine, 3,4-dichloro-5-(2-chloroethoxy)-
  • 3,4-Dichloro-5-(2-chloroethoxy)pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.