CymitQuimica logo

CAS 1346698-29-0

:

2-[(5,6-Dichloro-4-pyridazinyl)oxy]-N,N-dimethylethanamine

Description:
2-[(5,6-Dichloro-4-pyridazinyl)oxy]-N,N-dimethylethanamine is a chemical compound characterized by its unique structure, which includes a pyridazine ring substituted with two chlorine atoms and an ether linkage. The presence of the dimethylamino group contributes to its basicity and potential for forming salts. This compound is typically classified as an organic amine and may exhibit properties such as moderate solubility in polar solvents due to the presence of the ether and amine functional groups. Its dichloro substitution pattern can influence its reactivity and biological activity, making it of interest in medicinal chemistry and agrochemical applications. The compound's molecular interactions may be significant in drug design, particularly in targeting specific biological pathways. Safety and handling considerations are essential, as halogenated compounds can pose environmental and health risks. Overall, this compound's structural features suggest potential utility in various chemical and pharmaceutical contexts, warranting further investigation into its properties and applications.
Formula:C8H11Cl2N3O
InChI:InChI=1S/C8H11Cl2N3O/c1-13(2)3-4-14-6-5-11-12-8(10)7(6)9/h5H,3-4H2,1-2H3
InChI key:InChIKey=ZPAYQUJCLSTUDY-UHFFFAOYSA-N
SMILES:O(CCN(C)C)C=1C(Cl)=C(Cl)N=NC1
Synonyms:
  • 2-[(5,6-Dichloro-4-pyridazinyl)oxy]-N,N-dimethylethanamine
  • Ethanamine, 2-[(5,6-dichloro-4-pyridazinyl)oxy]-N,N-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.