CymitQuimica logo

CAS 1346698-33-6

:

3-Chloro-5-(2-methylpropoxy)pyridazine

Description:
3-Chloro-5-(2-methylpropoxy)pyridazine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a 2-methylpropoxy group at the 5-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of the ether functional group in the propoxy moiety, which can influence its solubility in various solvents. The chlorinated pyridazine structure may impart biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the branched alkyl group can affect its lipophilicity and potential interactions with biological targets. As with many heterocyclic compounds, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, depending on the reaction conditions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H11ClN2O
InChI:InChI=1S/C8H11ClN2O/c1-6(2)5-12-7-3-8(9)11-10-4-7/h3-4,6H,5H2,1-2H3
InChI key:InChIKey=FDPGQASHPXTQKC-UHFFFAOYSA-N
SMILES:O(CC(C)C)C=1C=C(Cl)N=NC1
Synonyms:
  • Pyridazine, 3-chloro-5-(2-methylpropoxy)-
  • 3-Chloro-5-(2-methylpropoxy)pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.