CymitQuimica logo

CAS 1346698-34-7

:

3-Chloro-5-(1-methylpropoxy)pyridazine

Description:
3-Chloro-5-(1-methylpropoxy)pyridazine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a 1-methylpropoxy group at the 5-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of the ether functional group in the propoxy moiety, which can influence its solubility in various solvents. The chlorinated pyridazine structure may impart specific reactivity, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications. Additionally, the presence of the alkyl group can enhance lipophilicity, affecting its biological activity and interaction with biological systems. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the chlorine substituent may pose certain hazards. Overall, 3-Chloro-5-(1-methylpropoxy)pyridazine represents a compound with diverse potential applications in research and industry.
Formula:C8H11ClN2O
InChI:InChI=1S/C8H11ClN2O/c1-3-6(2)12-7-4-8(9)11-10-5-7/h4-6H,3H2,1-2H3
InChI key:InChIKey=QVLMBFLKBRBWBT-UHFFFAOYSA-N
SMILES:O(C(CC)C)C=1C=C(Cl)N=NC1
Synonyms:
  • 3-Chloro-5-(1-methylpropoxy)pyridazine
  • Pyridazine, 3-chloro-5-(1-methylpropoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.