
CAS 1346698-35-8
:3-Chloro-5-(1,1-dimethylethoxy)pyridazine
Description:
3-Chloro-5-(1,1-dimethylethoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a chlorine atom at the 3-position and a bulky 1,1-dimethylethoxy group at the 5-position contributes to its unique reactivity and solubility properties. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its structure suggests potential for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the chlorine atom. The bulky ether group can influence the steric and electronic properties, affecting its interactions with other molecules. Safety data and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact. Overall, 3-Chloro-5-(1,1-dimethylethoxy)pyridazine is a versatile compound with applications in chemical research and development.
Formula:C8H11ClN2O
InChI:InChI=1S/C8H11ClN2O/c1-8(2,3)12-6-4-7(9)11-10-5-6/h4-5H,1-3H3
InChI key:InChIKey=SCEZYUNDBQPPBX-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C=1C=C(Cl)N=NC1
Synonyms:- Pyridazine, 3-chloro-5-(1,1-dimethylethoxy)-
- 3-Chloro-5-(1,1-dimethylethoxy)pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
