
CAS 1346698-36-9
:3-Chloro-5-(pentyloxy)pyridazine
Description:
3-Chloro-5-(pentyloxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a pentyloxy group at the 5-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the pentyloxy substituent, which can enhance solubility in organic solvents. The chlorine atom may impart some reactivity, making it a potential candidate for further chemical modifications or reactions. Additionally, the structure suggests potential applications in medicinal chemistry or as an intermediate in organic synthesis. The presence of the pentyloxy group may also influence its biological activity, potentially affecting interactions with biological targets. Overall, 3-Chloro-5-(pentyloxy)pyridazine is a compound of interest for research and development in various chemical and pharmaceutical applications.
Formula:C9H13ClN2O
InChI:InChI=1S/C9H13ClN2O/c1-2-3-4-5-13-8-6-9(10)12-11-7-8/h6-7H,2-5H2,1H3
InChI key:InChIKey=DMSDTKFYZDFSSM-UHFFFAOYSA-N
SMILES:O(CCCCC)C=1C=C(Cl)N=NC1
Synonyms:- Pyridazine, 3-chloro-5-(pentyloxy)-
- 3-Chloro-5-(pentyloxy)pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
