CAS 1346698-37-0
:3-Chloro-5-(3-methylbutoxy)pyridazine
Description:
3-Chloro-5-(3-methylbutoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a chlorine atom at the 3-position and a 3-methylbutoxy group at the 5-position contributes to its unique chemical properties. This compound may exhibit moderate to high lipophilicity due to the alkoxy substituent, which can influence its solubility in organic solvents. The chlorine atom can also impart reactivity, making it a potential candidate for further chemical modifications. In terms of applications, compounds like this may be explored in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Safety and handling considerations are essential, as halogenated compounds can pose environmental and health risks. Overall, 3-Chloro-5-(3-methylbutoxy)pyridazine represents a class of compounds with diverse potential applications, driven by its structural features and reactivity.
Formula:C9H13ClN2O
InChI:InChI=1S/C9H13ClN2O/c1-7(2)3-4-13-8-5-9(10)12-11-6-8/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=CYVMFXRCYIQQTL-UHFFFAOYSA-N
SMILES:O(CCC(C)C)C=1C=C(Cl)N=NC1
Synonyms:- Pyridazine, 3-chloro-5-(3-methylbutoxy)-
- 3-Chloro-5-(3-methylbutoxy)pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
