CAS 13467-26-0
:gly-phe amide acetate
Description:
Gly-Phe amide acetate, with the CAS number 13467-26-0, is a synthetic compound that is derived from the amino acids glycine (Gly) and phenylalanine (Phe). This compound typically exists as a white to off-white solid and is soluble in polar solvents such as water and methanol, which is indicative of its amide functional group. Gly-Phe amide acetate may exhibit biological activity, potentially serving as a peptide or peptide-like molecule in various biochemical applications. Its structure suggests that it could participate in hydrogen bonding due to the presence of the amide group, influencing its interactions in biological systems. Additionally, the acetate moiety may confer certain stability and solubility characteristics. As with many peptide derivatives, it may be of interest in pharmaceutical research, particularly in the development of therapeutics targeting specific biological pathways. However, detailed studies on its pharmacokinetics, toxicity, and specific biological functions would be necessary to fully understand its potential applications.
Formula:C13H19N3O4
InChI:InChI=1/C11H15N3O2.C2H4O2/c12-7-10(15)14-9(11(13)16)6-8-4-2-1-3-5-8;1-2(3)4/h1-5,9H,6-7,12H2,(H2,13,16)(H,14,15);1H3,(H,3,4)
SMILES:c1ccc(cc1)CC(C(=N)O)N=C(CN)O.CC(=O)O
Synonyms:- H-Gly-Phe-NH2
- Glycyl-L-phenylalaninamide acetate
- Glycylphenylalaninamide Acetate (1:1)
- H-Gly-Phe-Nh2 Hcl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Gly-Phe-NH2• AcOH
CAS:Controlled Product<p>Gly-Phe-NH2 is an amino acid that can be used as a research tool in the study of protein interactions, receptor activation, and ion channels. It has been shown to activate ligands such as peptides and antibodies. This compound also inhibits ligands in the cell biology field. Gly-Phe-NH2• AcOH is a white powder with a purity of 99%.</p>Formula:C11H15N3O2•CH3COOHPurity:Min. 95%Molecular weight:281.31 g/molH-Gly-Phe-NH2 acetate salt
CAS:Please enquire for more information about H-Gly-Phe-NH2 acetate salt including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C11H15N3O2·C2H4O2Purity:Min. 95%Molecular weight:281.31 g/mol

