CAS 134670-14-7

Ethanone, 2,2,2-trifluoro-1-(6-methylimidazo[2,1-b]thiazol-5-yl)-

Description:

Ethanone, 2,2,2-trifluoro-1-(6-methylimidazo[2,1-b]thiazol-5-yl)-, identified by CAS number 134670-14-7, is a chemical compound characterized by its unique structure that combines a trifluoroethyl group with a substituted imidazo-thiazole moiety. This compound typically exhibits properties associated with both its fluorinated and heterocyclic components, such as increased lipophilicity and potential biological activity. The presence of trifluoromethyl groups often enhances the stability and reactivity of the molecule, making it of interest in medicinal chemistry and material science. Additionally, the imidazo-thiazole structure may contribute to its pharmacological properties, potentially influencing interactions with biological targets. As with many fluorinated compounds, it may also exhibit distinct solubility and volatility characteristics compared to its non-fluorinated counterparts. Safety and handling considerations are essential, as fluorinated compounds can pose specific environmental and health risks. Overall, this compound represents a fascinating intersection of organic chemistry and potential therapeutic applications.

Formula: C₈H₅F₃N₂OS

InChI: InChI=1S/C8H5F3N2OS/c1-4-5(6(14)8(9,10)11)13-2-3-15-7(13)12-4/h2-3H,1H3

InChI key: InChIKey=JGXHHYIATBFMJM-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C=1N2C(=NC1C)SC=C2

Synonyms:

• Ethanone, 2,2,2-trifluoro-1-(6-methylimidazo[2,1-b]thiazol-5-yl)-
• Imidazo[2,1-b]thiazole, ethanone deriv.
• 2,2,2-Trifluoro-1-[6-methylimidazo[2,1-b][1,3]thiazol-5-yl]ethan-1-one