CymitQuimica logo

CAS 1346706-96-4

:

4-Chloro-2-(1-methylbutoxy)pyridine

Description:
4-Chloro-2-(1-methylbutoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a 1-methylbutoxy group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, reflecting its hydrophobic characteristics due to the alkyl group. The chlorine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Chloro-2-(1-methylbutoxy)pyridine is notable for its structural features and potential utility in organic synthesis and medicinal chemistry.
Formula:C10H14ClNO
InChI:InChI=1S/C10H14ClNO/c1-3-4-8(2)13-10-7-9(11)5-6-12-10/h5-8H,3-4H2,1-2H3
InChI key:InChIKey=HSAFGYUJODYUTJ-UHFFFAOYSA-N
SMILES:O(C(CCC)C)C1=CC(Cl)=CC=N1
Synonyms:
  • 4-Chloro-2-(1-methylbutoxy)pyridine
  • Pyridine, 4-chloro-2-(1-methylbutoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.