CymitQuimica logo

CAS 1346706-97-5

:

4-Chloro-2-(1-ethylpropoxy)pyridine

Description:
4-Chloro-2-(1-ethylpropoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and an ethylpropoxy group at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and the ether functionality of the propoxy group, influencing its solubility in various solvents. It may participate in nucleophilic substitution reactions due to the presence of the chlorine atom, making it a potential intermediate in organic synthesis. Additionally, the structure suggests potential biological activity, as many pyridine derivatives are known for their pharmacological properties. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4-Chloro-2-(1-ethylpropoxy)pyridine represents a versatile compound with applications in chemical synthesis and possibly in medicinal chemistry.
Formula:C10H14ClNO
InChI:InChI=1S/C10H14ClNO/c1-3-9(4-2)13-10-7-8(11)5-6-12-10/h5-7,9H,3-4H2,1-2H3
InChI key:InChIKey=DLWHRFLSOXRCDG-UHFFFAOYSA-N
SMILES:O(C(CC)CC)C1=CC(Cl)=CC=N1
Synonyms:
  • 4-Chloro-2-(1-ethylpropoxy)pyridine
  • Pyridine, 4-chloro-2-(1-ethylpropoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.