CymitQuimica logo

CAS 1346706-99-7

:

4-Chloro-2-(cyclobutyloxy)pyridine

Description:
4-Chloro-2-(cyclobutyloxy)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 4-position with a chlorine atom and at the 2-position with a cyclobutyloxy group. This structure imparts unique properties to the compound, including potential biological activity and solubility characteristics influenced by the presence of the cyclobutyl group. The chlorine atom enhances the compound's reactivity and may affect its interaction with biological targets. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The presence of the cyclobutyloxy moiety can contribute to the compound's steric and electronic properties, influencing its behavior in chemical reactions and interactions with other molecules. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 4-Chloro-2-(cyclobutyloxy)pyridine represents a class of compounds with diverse applications in chemical research and development.
Formula:C9H10ClNO
InChI:InChI=1S/C9H10ClNO/c10-7-4-5-11-9(6-7)12-8-2-1-3-8/h4-6,8H,1-3H2
InChI key:InChIKey=JUSLRTVTCLFHMZ-UHFFFAOYSA-N
SMILES:O(C1=CC(Cl)=CC=N1)C2CCC2
Synonyms:
  • Pyridine, 4-chloro-2-(cyclobutyloxy)-
  • 4-Chloro-2-(cyclobutyloxy)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.