CAS 1346707-03-6
:4-Chloro-2-(cyclobutylmethoxy)pyridine
Description:
4-Chloro-2-(cyclobutylmethoxy)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a cyclobutylmethoxy group at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and the methoxy group, influencing its solubility in various solvents. The cyclobutyl group introduces a degree of strain and rigidity, which can affect the compound's reactivity and interaction with biological targets. Such structural features may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and potential applications can be influenced by factors such as temperature, pH, and the presence of other chemical species. Overall, 4-Chloro-2-(cyclobutylmethoxy)pyridine represents a versatile structure with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H12ClNO
InChI:InChI=1S/C10H12ClNO/c11-9-4-5-12-10(6-9)13-7-8-2-1-3-8/h4-6,8H,1-3,7H2
InChI key:InChIKey=AIHYURCRXUVYGQ-UHFFFAOYSA-N
SMILES:O(CC1CCC1)C2=CC(Cl)=CC=N2
Synonyms:- 4-Chloro-2-(cyclobutylmethoxy)pyridine
- Pyridine, 4-chloro-2-(cyclobutylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
