CymitQuimica logo

CAS 1346707-05-8

:

4-Chloro-2-(cyclohexylmethoxy)pyridine

Description:
4-Chloro-2-(cyclohexylmethoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a cyclohexylmethoxy group at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and the methoxy group, influencing its solubility in various solvents. The cyclohexyl group may impart hydrophobic characteristics, affecting its interaction with biological systems and potential applications in medicinal chemistry. Additionally, the compound may exhibit specific reactivity patterns typical of substituted pyridines, such as electrophilic aromatic substitution or nucleophilic attack at the nitrogen atom. Its structural features suggest potential utility in the development of pharmaceuticals or agrochemicals, although specific biological activity would require further investigation. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C12H16ClNO
InChI:InChI=1S/C12H16ClNO/c13-11-6-7-14-12(8-11)15-9-10-4-2-1-3-5-10/h6-8,10H,1-5,9H2
InChI key:InChIKey=DYHOQGMBXFJEGV-UHFFFAOYSA-N
SMILES:O(CC1CCCCC1)C2=CC(Cl)=CC=N2
Synonyms:
  • Pyridine, 4-chloro-2-(cyclohexylmethoxy)-
  • 4-Chloro-2-(cyclohexylmethoxy)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.