CAS 1346707-06-9
:4-Chloro-2-[(2-fluorophenyl)methoxy]pyridine
Description:
4-Chloro-2-[(2-fluorophenyl)methoxy]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 4-position and a methoxy group linked to a 2-fluorophenyl moiety at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and fluorine substituents, which can influence its solubility in various solvents. The methoxy group enhances its potential for hydrogen bonding, affecting its reactivity and interaction with biological systems. Additionally, the presence of the fluorine atom may impart specific electronic characteristics, making it of interest in medicinal chemistry and drug design. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. However, detailed studies on its biological activity and safety profile would be necessary to fully understand its potential uses.
Formula:C12H9ClFNO
InChI:InChI=1S/C12H9ClFNO/c13-10-5-6-15-12(7-10)16-8-9-3-1-2-4-11(9)14/h1-7H,8H2
InChI key:InChIKey=KRPFJSQWPWHRAJ-UHFFFAOYSA-N
SMILES:C(OC1=CC(Cl)=CC=N1)C2=C(F)C=CC=C2
Synonyms:- 4-Chloro-2-[(2-fluorophenyl)methoxy]pyridine
- Pyridine, 4-chloro-2-[(2-fluorophenyl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
