CymitQuimica logo

CAS 1346707-09-2

:

4-Chloro-2-[(2-chlorophenyl)methoxy]pyridine

Description:
4-Chloro-2-[(2-chlorophenyl)methoxy]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro substituent at the 4-position and a methoxy group linked to a 2-chlorophenyl moiety at the 2-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both halogen and ether functionalities, which can influence its interaction with biological targets. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be determined through experimental methods, providing insights into its stability and reactivity. As with many halogenated compounds, it is important to consider environmental and safety aspects during handling and disposal.
Formula:C12H9Cl2NO
InChI:InChI=1S/C12H9Cl2NO/c13-10-5-6-15-12(7-10)16-8-9-3-1-2-4-11(9)14/h1-7H,8H2
InChI key:InChIKey=CXDHFCRWCORRJS-UHFFFAOYSA-N
SMILES:C(OC1=CC(Cl)=CC=N1)C2=C(Cl)C=CC=C2
Synonyms:
  • 4-Chloro-2-[(2-chlorophenyl)methoxy]pyridine
  • Pyridine, 4-chloro-2-[(2-chlorophenyl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.