CAS 1346707-13-8
:4-Chloro-2-[(3-methoxyphenyl)methoxy]pyridine
Description:
4-Chloro-2-[(3-methoxyphenyl)methoxy]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro substituent at the 4-position and a methoxyphenyl group at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of both the chloro and methoxy groups, which can influence its solubility in various solvents. The methoxy group can also participate in hydrogen bonding, affecting its reactivity and interaction with biological systems. Additionally, the compound may possess potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the structural features that can interact with biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as chromatography. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents, which can pose environmental and health risks.
Formula:C13H12ClNO2
InChI:InChI=1S/C13H12ClNO2/c1-16-12-4-2-3-10(7-12)9-17-13-8-11(14)5-6-15-13/h2-8H,9H2,1H3
InChI key:InChIKey=WIIJHSCBJCLNGU-UHFFFAOYSA-N
SMILES:C(OC1=CC(Cl)=CC=N1)C2=CC(OC)=CC=C2
Synonyms:- Pyridine, 4-chloro-2-[(3-methoxyphenyl)methoxy]-
- 4-Chloro-2-[(3-methoxyphenyl)methoxy]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
