CAS 1346707-14-9
:4-Chloro-2-[(4-methoxyphenyl)methoxy]pyridine
Description:
4-Chloro-2-[(4-methoxyphenyl)methoxy]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a methoxyphenylmethoxy group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic nature. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the methoxy groups can influence biological activity and solubility. The chlorine substituent may also enhance the compound's reactivity and interaction with biological targets. Additionally, the presence of the pyridine moiety can impart basicity, which may affect its behavior in various chemical reactions. Overall, 4-Chloro-2-[(4-methoxyphenyl)methoxy]pyridine is a compound of interest for further research in organic synthesis and drug development.
Formula:C13H12ClNO2
InChI:InChI=1S/C13H12ClNO2/c1-16-12-4-2-10(3-5-12)9-17-13-8-11(14)6-7-15-13/h2-8H,9H2,1H3
InChI key:InChIKey=OPOLCIAJEBGFOH-UHFFFAOYSA-N
SMILES:C(OC1=CC(Cl)=CC=N1)C2=CC=C(OC)C=C2
Synonyms:- 4-Chloro-2-[(4-methoxyphenyl)methoxy]pyridine
- Pyridine, 4-chloro-2-[(4-methoxyphenyl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
