CAS 1346707-15-0
:2-[[(4-Chloro-2-pyridinyl)oxy]methyl]benzonitrile
Description:
2-[[(4-Chloro-2-pyridinyl)oxy]methyl]benzonitrile, identified by its CAS number 1346707-15-0, is a chemical compound characterized by its complex structure, which includes a benzonitrile moiety and a pyridine ring. This compound features a chloro substituent on the pyridine, contributing to its potential biological activity. The presence of the nitrile group indicates that it may exhibit polar characteristics, influencing its solubility and reactivity. The ether-like linkage between the pyridine and the benzonitrile suggests that it may participate in various chemical reactions, including nucleophilic substitutions. Additionally, the chloro group can enhance the compound's lipophilicity, potentially affecting its pharmacokinetic properties if considered for medicinal applications. Overall, this compound's unique structural features may render it of interest in fields such as medicinal chemistry, agrochemicals, or materials science, where its reactivity and biological properties can be further explored.
Formula:C13H9ClN2O
InChI:InChI=1S/C13H9ClN2O/c14-12-5-6-16-13(7-12)17-9-11-4-2-1-3-10(11)8-15/h1-7H,9H2
InChI key:InChIKey=VPCVSMYWGVUNLE-UHFFFAOYSA-N
SMILES:C(OC1=CC(Cl)=CC=N1)C2=C(C#N)C=CC=C2
Synonyms:- Benzonitrile, 2-[[(4-chloro-2-pyridinyl)oxy]methyl]-
- 2-[[(4-Chloro-2-pyridinyl)oxy]methyl]benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
