CymitQuimica logo

CAS 1346707-16-1

:

3-[[(4-Chloro-2-pyridinyl)oxy]methyl]benzonitrile

Description:
3-[[(4-Chloro-2-pyridinyl)oxy]methyl]benzonitrile, identified by its CAS number 1346707-16-1, is a chemical compound that features a complex structure comprising a benzonitrile moiety and a pyridine derivative. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals due to its unique functional groups. The presence of the chloro substituent on the pyridine ring may influence its reactivity and biological activity, while the benzonitrile group contributes to its aromatic properties. The compound's solubility can vary depending on the solvent, and it may demonstrate specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its synthesis may involve standard organic reactions, including nucleophilic substitutions and coupling reactions. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, ensuring proper safety protocols are followed during its use in laboratory or industrial settings.
Formula:C13H9ClN2O
InChI:InChI=1S/C13H9ClN2O/c14-12-4-5-16-13(7-12)17-9-11-3-1-2-10(6-11)8-15/h1-7H,9H2
InChI key:InChIKey=LSMGITPAAZWGJL-UHFFFAOYSA-N
SMILES:C(OC1=CC(Cl)=CC=N1)C2=CC(C#N)=CC=C2
Synonyms:
  • 3-[[(4-Chloro-2-pyridinyl)oxy]methyl]benzonitrile
  • Benzonitrile, 3-[[(4-chloro-2-pyridinyl)oxy]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.