CAS 1346707-17-2
:4-[[(4-Chloro-2-pyridinyl)oxy]methyl]benzonitrile
Description:
4-[[(4-Chloro-2-pyridinyl)oxy]methyl]benzonitrile, identified by its CAS number 1346707-17-2, is a chemical compound characterized by its complex structure, which includes a benzonitrile moiety and a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The chloro substituent on the pyridine ring can influence its electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. The presence of the nitrile group contributes to its polarity and can affect solubility in various solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis and applications may involve various organic chemistry techniques, including substitution reactions and functional group transformations. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and material science.
Formula:C13H9ClN2O
InChI:InChI=1S/C13H9ClN2O/c14-12-5-6-16-13(7-12)17-9-11-3-1-10(8-15)2-4-11/h1-7H,9H2
InChI key:InChIKey=MZEUFUAUALZLEE-UHFFFAOYSA-N
SMILES:C(OC1=CC(Cl)=CC=N1)C2=CC=C(C#N)C=C2
Synonyms:- Benzonitrile, 4-[[(4-chloro-2-pyridinyl)oxy]methyl]-
- 4-[[(4-Chloro-2-pyridinyl)oxy]methyl]benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
