
CAS 1346707-18-3
:4-Chloro-2-[[2-(trifluoromethyl)phenyl]methoxy]pyridine
Description:
4-Chloro-2-[[2-(trifluoromethyl)phenyl]methoxy]pyridine, identified by its CAS number 1346707-18-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chloro group and a methoxy group linked to a trifluoromethylphenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of electronegative substituents. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the chloro substituent may impart unique electronic properties, affecting the compound's reactivity and interactions with biological targets. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation.
Formula:C13H9ClF3NO
InChI:InChI=1S/C13H9ClF3NO/c14-10-5-6-18-12(7-10)19-8-9-3-1-2-4-11(9)13(15,16)17/h1-7H,8H2
InChI key:InChIKey=AEKQQFNPDJFCKR-UHFFFAOYSA-N
SMILES:C(OC1=CC(Cl)=CC=N1)C2=C(C(F)(F)F)C=CC=C2
Synonyms:- 4-Chloro-2-[[2-(trifluoromethyl)phenyl]methoxy]pyridine
- Pyridine, 4-chloro-2-[[2-(trifluoromethyl)phenyl]methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
