
CAS 1346707-19-4
:4-Chloro-2-[[3-(trifluoromethyl)phenyl]methoxy]pyridine
Description:
4-Chloro-2-[[3-(trifluoromethyl)phenyl]methoxy]pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chloro group and a methoxy group linked to a phenyl ring that carries a trifluoromethyl group. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, reflecting its polar and non-polar characteristics due to the presence of both the pyridine and phenyl moieties. The trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The chloro substituent can also affect the compound's reactivity and stability. As with many halogenated compounds, it may exhibit unique electronic properties, which can be leveraged in various applications, including medicinal chemistry and agrochemicals. Safety data should be consulted for handling and potential toxicity, as halogenated compounds can pose environmental and health risks.
Formula:C13H9ClF3NO
InChI:InChI=1S/C13H9ClF3NO/c14-11-4-5-18-12(7-11)19-8-9-2-1-3-10(6-9)13(15,16)17/h1-7H,8H2
InChI key:InChIKey=VIXVSBMZDFVXAZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(COC2=CC(Cl)=CC=N2)=CC=C1
Synonyms:- Pyridine, 4-chloro-2-[[3-(trifluoromethyl)phenyl]methoxy]-
- 4-Chloro-2-[[3-(trifluoromethyl)phenyl]methoxy]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
