CAS 1346707-21-8
:4-Chloro-2-(propylthio)pyridine
Description:
4-Chloro-2-(propylthio)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a propylthio group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in pharmaceuticals and agrochemicals, particularly as an intermediate in the synthesis of various biologically active compounds. The presence of the chlorine atom can enhance its reactivity, while the propylthio group may influence its solubility and interaction with biological systems. As with many chlorinated compounds, it is essential to handle 4-Chloro-2-(propylthio)pyridine with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in laboratory or industrial settings.
Formula:C8H10ClNS
InChI:InChI=1S/C8H10ClNS/c1-2-5-11-8-6-7(9)3-4-10-8/h3-4,6H,2,5H2,1H3
InChI key:InChIKey=LOLREXZCRCETIG-UHFFFAOYSA-N
SMILES:S(CCC)C1=CC(Cl)=CC=N1
Synonyms:- 4-Chloro-2-(propylthio)pyridine
- Pyridine, 4-chloro-2-(propylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
