CymitQuimica logo

CAS 1346707-26-3

:

4-Chloro-2-[(2-methylpropyl)thio]pyridine

Description:
4-Chloro-2-[(2-methylpropyl)thio]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a thioether group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits moderate solubility in organic solvents, reflecting its hydrophobic nature due to the alkyl thioether substituent. The thioether group can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the chlorine atom can participate in electrophilic aromatic substitution reactions. This compound may have applications in pharmaceuticals or agrochemicals, given the structural motifs often associated with biological activity. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Chloro-2-[(2-methylpropyl)thio]pyridine is a versatile compound with potential utility in synthetic chemistry.
Formula:C9H12ClNS
InChI:InChI=1S/C9H12ClNS/c1-7(2)6-12-9-5-8(10)3-4-11-9/h3-5,7H,6H2,1-2H3
InChI key:InChIKey=JKXBIDZNVMWKIV-UHFFFAOYSA-N
SMILES:S(CC(C)C)C1=CC(Cl)=CC=N1
Synonyms:
  • 4-Chloro-2-[(2-methylpropyl)thio]pyridine
  • Pyridine, 4-chloro-2-[(2-methylpropyl)thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.