CAS 1346707-29-6
:4-Chloro-2-(pentylthio)pyridine
Description:
4-Chloro-2-(pentylthio)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a pentylthio group at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and the sulfur atom in the thioether group, influencing its solubility in various solvents. The pentylthio group can enhance its lipophilicity, potentially affecting its biological activity and interactions with other molecules. As a pyridine derivative, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, compounds like this can be of interest in medicinal chemistry and material science due to their potential applications in pharmaceuticals or as intermediates in organic synthesis. Safety and handling precautions should be observed, as with many halogenated and sulfur-containing compounds, due to potential toxicity and environmental impact.
Formula:C10H14ClNS
InChI:InChI=1S/C10H14ClNS/c1-2-3-4-7-13-10-8-9(11)5-6-12-10/h5-6,8H,2-4,7H2,1H3
InChI key:InChIKey=FJFXFYHRXWZFML-UHFFFAOYSA-N
SMILES:S(CCCCC)C1=CC(Cl)=CC=N1
Synonyms:- Pyridine, 4-chloro-2-(pentylthio)-
- 4-Chloro-2-(pentylthio)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
