CAS 1346707-37-6
:4-Chloro-2-(cyclopentylthio)pyridine
Description:
4-Chloro-2-(cyclopentylthio)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a cyclopentylthio group at the 2-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the thioether and halogen functionalities, which can influence biological activity. Additionally, the cyclopentyl group may enhance lipophilicity, potentially affecting the compound's pharmacokinetics. Safety data and handling precautions should be considered, as with any chemical, to mitigate risks associated with its use. Overall, 4-Chloro-2-(cyclopentylthio)pyridine represents a compound of interest for further research and application in various chemical and pharmaceutical contexts.
Formula:C10H12ClNS
InChI:InChI=1S/C10H12ClNS/c11-8-5-6-12-10(7-8)13-9-3-1-2-4-9/h5-7,9H,1-4H2
InChI key:InChIKey=MTMYTUUMTNIBRF-UHFFFAOYSA-N
SMILES:S(C1=CC(Cl)=CC=N1)C2CCCC2
Synonyms:- Pyridine, 4-chloro-2-(cyclopentylthio)-
- 4-Chloro-2-(cyclopentylthio)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
