
CAS 1346707-39-8
:4-Chloro-2-[(cyclopropylmethyl)thio]pyridine
Description:
4-Chloro-2-[(cyclopropylmethyl)thio]pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a cyclopropylmethylthio group at the 2-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound may exhibit properties such as moderate to high lipophilicity due to the cyclopropylmethyl group, which can influence its bioavailability and interaction with biological targets. Additionally, the thioether functionality can participate in various chemical reactions, including nucleophilic substitutions and oxidation processes. The compound's structural features suggest potential uses in the development of pharmaceuticals or agrochemicals, particularly in the design of compounds targeting specific biological pathways. As with many heterocyclic compounds, its solubility, stability, and reactivity can be influenced by the presence of the chlorine atom and the overall electronic distribution within the molecule.
Formula:C9H10ClNS
InChI:InChI=1S/C9H10ClNS/c10-8-3-4-11-9(5-8)12-6-7-1-2-7/h3-5,7H,1-2,6H2
InChI key:InChIKey=FNKDPRGSPDXFOF-UHFFFAOYSA-N
SMILES:C(SC1=CC(Cl)=CC=N1)C2CC2
Synonyms:- Pyridine, 4-chloro-2-[(cyclopropylmethyl)thio]-
- 4-Chloro-2-[(cyclopropylmethyl)thio]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
