CAS 1346707-40-1
:4-Chloro-2-[(cyclobutylmethyl)thio]pyridine
Description:
4-Chloro-2-[(cyclobutylmethyl)thio]pyridine is an organic compound characterized by its pyridine ring, which is substituted at the 4-position with a chlorine atom and at the 2-position with a cyclobutylmethylthio group. This compound features a heterocyclic aromatic structure, which contributes to its chemical reactivity and potential biological activity. The presence of the chlorine atom enhances its electrophilic properties, while the cyclobutylmethylthio group introduces steric hindrance and may influence its interaction with biological targets. The compound is likely to exhibit moderate solubility in organic solvents, and its thioether functionality may participate in various chemical reactions, such as nucleophilic substitutions or oxidation processes. Additionally, the structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C10H12ClNS
InChI:InChI=1S/C10H12ClNS/c11-9-4-5-12-10(6-9)13-7-8-2-1-3-8/h4-6,8H,1-3,7H2
InChI key:InChIKey=SIRXRXQYDXAWND-UHFFFAOYSA-N
SMILES:S(CC1CCC1)C2=CC(Cl)=CC=N2
Synonyms:- 4-Chloro-2-[(cyclobutylmethyl)thio]pyridine
- Pyridine, 4-chloro-2-[(cyclobutylmethyl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
