CAS 1346707-42-3
:4-Chloro-2-[(cyclohexylmethyl)thio]pyridine
Description:
4-Chloro-2-[(cyclohexylmethyl)thio]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a cyclohexylmethylthio group at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and the sulfur atom in the thioether group, which can influence its solubility in various solvents. The cyclohexylmethyl group adds hydrophobic characteristics, potentially affecting its interactions in biological systems. The compound may participate in nucleophilic substitution reactions due to the presence of the chlorine atom, making it a candidate for further chemical transformations. Additionally, its structural features suggest potential applications in pharmaceuticals or agrochemicals, where modifications of pyridine derivatives are common. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C12H16ClNS
InChI:InChI=1S/C12H16ClNS/c13-11-6-7-14-12(8-11)15-9-10-4-2-1-3-5-10/h6-8,10H,1-5,9H2
InChI key:InChIKey=VUPBWJKYTMAQOA-UHFFFAOYSA-N
SMILES:S(CC1CCCCC1)C2=CC(Cl)=CC=N2
Synonyms:- Pyridine, 4-chloro-2-[(cyclohexylmethyl)thio]-
- 4-Chloro-2-[(cyclohexylmethyl)thio]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
