CymitQuimica logo

CAS 1346707-50-3

:

4-Chloro-2-[[(3-chlorophenyl)methyl]thio]pyridine

Description:
4-Chloro-2-[[(3-chlorophenyl)methyl]thio]pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro substituent at the 4-position and a thioether group at the 2-position contributes to its reactivity and potential biological activity. The compound also features a 3-chlorophenyl group attached via a methylthio linkage, which can influence its lipophilicity and interaction with biological targets. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's properties, such as solubility, stability, and reactivity, can be affected by the electron-withdrawing nature of the chlorine atoms and the sulfur atom's ability to participate in various chemical reactions. Overall, 4-Chloro-2-[[(3-chlorophenyl)methyl]thio]pyridine is of interest for its potential applications in drug discovery and development, particularly in targeting specific biological pathways.
Formula:C12H9Cl2NS
InChI:InChI=1S/C12H9Cl2NS/c13-10-3-1-2-9(6-10)8-16-12-7-11(14)4-5-15-12/h1-7H,8H2
InChI key:InChIKey=LIDRENGHLRBFNQ-UHFFFAOYSA-N
SMILES:C(SC1=CC(Cl)=CC=N1)C2=CC(Cl)=CC=C2
Synonyms:
  • 4-Chloro-2-[[(3-chlorophenyl)methyl]thio]pyridine
  • Pyridine, 4-chloro-2-[[(3-chlorophenyl)methyl]thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.