CAS 1346707-51-4
:4-Chloro-2-[[(4-chlorophenyl)methyl]thio]pyridine
Description:
4-Chloro-2-[[(4-chlorophenyl)methyl]thio]pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 4-position and a thioether linkage with a 4-chlorobenzyl group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the pyridine and chlorophenyl moieties, which can influence biological activity. Additionally, the compound may exhibit specific reactivity patterns typical of thioether and halogenated compounds, making it of interest for further chemical synthesis and study. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C12H9Cl2NS
InChI:InChI=1S/C12H9Cl2NS/c13-10-3-1-9(2-4-10)8-16-12-7-11(14)5-6-15-12/h1-7H,8H2
InChI key:InChIKey=KXTLPSBPOMVHKX-UHFFFAOYSA-N
SMILES:C(SC1=CC(Cl)=CC=N1)C2=CC=C(Cl)C=C2
Synonyms:- 4-Chloro-2-[[(4-chlorophenyl)methyl]thio]pyridine
- Pyridine, 4-chloro-2-[[(4-chlorophenyl)methyl]thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
