
CAS 1346707-53-6
:2-[[(4-Chloro-2-pyridinyl)thio]methyl]benzonitrile
Description:
2-[[(4-Chloro-2-pyridinyl)thio]methyl]benzonitrile, identified by its CAS number 1346707-53-6, is a chemical compound that features a complex structure comprising a benzonitrile moiety and a thioether linkage to a pyridine ring. This compound typically exhibits characteristics common to organic molecules with heteroatoms, such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitrile and thioether functional groups. The chloro substituent on the pyridine ring may influence its electronic properties and reactivity, potentially enhancing its biological activity or interaction with other chemical species. The presence of the thioether group can also impart unique properties, such as increased lipophilicity and the ability to participate in various chemical reactions, including nucleophilic substitutions. Overall, this compound may be of interest in medicinal chemistry and material science due to its structural features and potential applications in drug development or as a synthetic intermediate.
Formula:C13H9ClN2S
InChI:InChI=1S/C13H9ClN2S/c14-12-5-6-16-13(7-12)17-9-11-4-2-1-3-10(11)8-15/h1-7H,9H2
InChI key:InChIKey=POWBKTNBZGPTKP-UHFFFAOYSA-N
SMILES:C(SC1=CC(Cl)=CC=N1)C2=C(C#N)C=CC=C2
Synonyms:- Benzonitrile, 2-[[(4-chloro-2-pyridinyl)thio]methyl]-
- 2-[[(4-Chloro-2-pyridinyl)thio]methyl]benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
