
CAS 1346707-61-6
:4-Chloro-2-[[[3-(trifluoromethyl)phenyl]methyl]thio]pyridine
Description:
4-Chloro-2-[[[3-(trifluoromethyl)phenyl]methyl]thio]pyridine, identified by its CAS number 1346707-61-6, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chloro group and a thioether linkage to a phenyl group that carries a trifluoromethyl substituent. This compound exhibits properties typical of heterocyclic compounds, including potential biological activity due to the presence of the pyridine moiety, which is known for its role in various pharmacological applications. The trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. Additionally, the presence of the chlorine atom may contribute to the compound's overall stability and solubility in organic solvents. The unique combination of these functional groups suggests that this compound could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents or agrochemicals. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.
Formula:C13H9ClF3NS
InChI:InChI=1S/C13H9ClF3NS/c14-11-4-5-18-12(7-11)19-8-9-2-1-3-10(6-9)13(15,16)17/h1-7H,8H2
InChI key:InChIKey=IGICJQOLMFUICV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(CSC2=CC(Cl)=CC=N2)=CC=C1
Synonyms:- 4-Chloro-2-[[[3-(trifluoromethyl)phenyl]methyl]thio]pyridine
- Pyridine, 4-chloro-2-[[[3-(trifluoromethyl)phenyl]methyl]thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-2-((3-(trifluoromethyl)benzyl)thio)pyridine
CAS:Formula:C13H9ClF3NSMolecular weight:303.7305
