CAS 1346707-73-0
:Methyl 3-[(4-chloro-2-pyridinyl)thio]propanoate
Description:
Methyl 3-[(4-chloro-2-pyridinyl)thio]propanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a methyl ester group, a propanoate backbone, and a thioether linkage with a pyridine ring that contains a chlorine substituent. The presence of the 4-chloro-2-pyridinyl group contributes to its potential biological activity, as pyridine derivatives are often associated with various pharmacological properties. The thioether functionality can influence the compound's reactivity and solubility, making it of interest in synthetic organic chemistry and medicinal chemistry. Additionally, the compound's molecular structure suggests it may exhibit specific interactions with biological targets, which could be explored for applications in drug development or agrochemicals. Overall, Methyl 3-[(4-chloro-2-pyridinyl)thio]propanoate represents a unique chemical entity with potential utility in various fields of research.
Formula:C9H10ClNO2S
InChI:InChI=1S/C9H10ClNO2S/c1-13-9(12)3-5-14-8-6-7(10)2-4-11-8/h2,4,6H,3,5H2,1H3
InChI key:InChIKey=JXIIHJYUTQABHW-UHFFFAOYSA-N
SMILES:S(CCC(OC)=O)C1=CC(Cl)=CC=N1
Synonyms:- Methyl 3-[(4-chloro-2-pyridinyl)thio]propanoate
- Propanoic acid, 3-[(4-chloro-2-pyridinyl)thio]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
