CAS 1346707-81-0
:4-Chloro-2-(4-pyridinylmethoxy)pyridine
Description:
4-Chloro-2-(4-pyridinylmethoxy)pyridine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic heterocycle containing nitrogen. The presence of a chloro substituent at the 4-position and a methoxy group linked to a 4-pyridinyl moiety at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine rings, which are often found in biologically active compounds. Additionally, the chlorine atom may influence its reactivity and interaction with biological targets. As with many pyridine derivatives, it may exhibit interesting electronic properties, making it a subject of study in various chemical and biological contexts. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C11H9ClN2O
InChI:InChI=1S/C11H9ClN2O/c12-10-3-6-14-11(7-10)15-8-9-1-4-13-5-2-9/h1-7H,8H2
InChI key:InChIKey=SCXRJWPFXOBGOY-UHFFFAOYSA-N
SMILES:O(CC=1C=CN=CC1)C2=CC(Cl)=CC=N2
Synonyms:- Pyridine, 4-chloro-2-(4-pyridinylmethoxy)-
- 4-Chloro-2-(4-pyridinylmethoxy)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
