CymitQuimica logo

CAS 1346707-82-1

:

4-Chloro-2-[(2-pyridinylmethyl)thio]pyridine

Description:
4-Chloro-2-[(2-pyridinylmethyl)thio]pyridine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing nitrogen. The presence of a chlorine atom at the 4-position and a thioether group at the 2-position contributes to its unique reactivity and potential applications in various fields, including medicinal chemistry and agrochemicals. The thioether linkage, specifically the 2-pyridinylmethyl group, enhances its ability to participate in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Additionally, its solubility and stability in different solvents can vary, influencing its practical applications. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with exposure. Overall, 4-Chloro-2-[(2-pyridinylmethyl)thio]pyridine represents a versatile compound with significant implications in chemical research and development.
Formula:C11H9ClN2S
InChI:InChI=1S/C11H9ClN2S/c12-9-4-6-14-11(7-9)15-8-10-3-1-2-5-13-10/h1-7H,8H2
InChI key:InChIKey=YJBUUKPFRARDDP-UHFFFAOYSA-N
SMILES:S(CC1=CC=CC=N1)C2=CC(Cl)=CC=N2
Synonyms:
  • Pyridine, 4-chloro-2-[(2-pyridinylmethyl)thio]-
  • 4-Chloro-2-[(2-pyridinylmethyl)thio]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.