CymitQuimica logo

CAS 1346707-83-2

:

4-Chloro-2-[(3-pyridinylmethyl)thio]pyridine

Description:
4-Chloro-2-[(3-pyridinylmethyl)thio]pyridine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing nitrogen. The presence of a chlorine atom at the 4-position and a thioether group at the 2-position contributes to its unique reactivity and potential applications in medicinal chemistry. The thioether moiety, derived from the 3-pyridinylmethyl group, enhances the compound's ability to participate in various chemical reactions, including nucleophilic substitutions and potential interactions with biological targets. This compound may exhibit biological activity, making it of interest in drug discovery and development. Its molecular structure suggests it could interact with specific receptors or enzymes, potentially leading to therapeutic effects. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which are critical for its application in various chemical and pharmaceutical contexts. As with many pyridine derivatives, it may also display properties such as antimicrobial or anti-inflammatory activities, warranting further investigation.
Formula:C11H9ClN2S
InChI:InChI=1S/C11H9ClN2S/c12-10-3-5-14-11(6-10)15-8-9-2-1-4-13-7-9/h1-7H,8H2
InChI key:InChIKey=IUAKQXPYGAKGNR-UHFFFAOYSA-N
SMILES:S(CC=1C=CC=NC1)C2=CC(Cl)=CC=N2
Synonyms:
  • Pyridine, 4-chloro-2-[(3-pyridinylmethyl)thio]-
  • 4-Chloro-2-[(3-pyridinylmethyl)thio]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.